C18H26ClNO2 — CID 138057941
4-chloro-3-[[4-methyl-4-(2-methylpropyl)piperidin-1-yl]methyl]benzoic acid (PubChem CID 138057941) has the molecular formula C18H26ClNO2 and a molecular weight of 323.86 g/mol. Its IUPAC name is 4-chloro-3-[[4-methyl-4-(2-methylpropyl)piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-chloro-3-[[4-methyl-4-(2-methylpropyl)piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 138057941 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-chloro-3-[[4-methyl-4-(2-methylpropyl)piperidin-1-yl]methyl]benzoic acid |
| SMILES | CC(C)CC1(C)CCN(Cc2cc(C(=O)O)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H26ClNO2/c1-13(2)11-18(3)6-8-20(9-7-18)12-15-10-14(17(21)22)4-5-16(15)19/h4-5,10,13H,6-9,11-12H2,1-3H3,(H,21,22) |
| InChIKey | XAXKSJQNJPJBKW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |