About 4-chloro-3-ethylbenzoic acid
4-chloro-3-ethylbenzoic acid (PubChem CID 21412279) has the molecular formula C9H9ClO2
and a molecular weight of 184.62 g/mol. Its IUPAC name is 4-chloro-3-ethylbenzoic acid.
Molecular Properties
| Compound Name | 4-chloro-3-ethylbenzoic acid |
| PubChem CID | 21412279 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 4-chloro-3-ethylbenzoic acid |
| SMILES | CCc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C9H9ClO2/c1-2-6-5-7(9(11)12)3-4-8(6)10/h3-5H,2H2,1H3,(H,11,12) |
| InChIKey | FLBWHXRCPBTVTL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-3-ethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-ethylbenzoic acid?
The IUPAC name of 4-chloro-3-ethylbenzoic acid (CID 21412279) is 4-chloro-3-ethylbenzoic acid.
What is the SMILES notation for 4-chloro-3-ethylbenzoic acid?
The canonical SMILES for 4-chloro-3-ethylbenzoic acid is CCc1cc(C(=O)O)ccc1Cl.
What is the InChIKey of 4-chloro-3-ethylbenzoic acid?
The InChIKey is FLBWHXRCPBTVTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO2/c1-2-6-5-7(9(11)12)3-4-8(6)10/h3-5H,2H2,1H3,(H,11,12).
What are the key properties of 4-chloro-3-ethylbenzoic acid?
4-chloro-3-ethylbenzoic acid has a molecular weight of 184.62 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-ethylbenzoic acid is sourced from PubChem (CID 21412279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).