C13H16Cl2O — CID 146008337
3-chloro-1-(4-chloro-3-ethylphenyl)-2,2-dimethylpropan-1-one (PubChem CID 146008337) has the molecular formula C13H16Cl2O and a molecular weight of 259.18 g/mol. Its IUPAC name is 3-chloro-1-(4-chloro-3-ethylphenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-(4-chloro-3-ethylphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 146008337 |
| Molecular Formula | C13H16Cl2O |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-chloro-1-(4-chloro-3-ethylphenyl)-2,2-dimethylpropan-1-one |
| SMILES | CCc1cc(C(=O)C(C)(C)CCl)ccc1Cl |
| InChI | InChI=1S/C13H16Cl2O/c1-4-9-7-10(5-6-11(9)15)12(16)13(2,3)8-14/h5-7H,4,8H2,1-3H3 |
| InChIKey | GCAYKUCUFWYPAU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|