C15H20FNO2S — CID 107456407
3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-4-fluorobenzoic acid (PubChem CID 107456407) has the molecular formula C15H20FNO2S and a molecular weight of 297.39 g/mol. Its IUPAC name is 3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-4-fluorobenzoic acid.
| Compound Name | 3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 107456407 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-4-fluorobenzoic acid |
| SMILES | CC1(C)CCN(Cc2cc(C(=O)O)ccc2F)CCS1 |
| InChI | InChI=1S/C15H20FNO2S/c1-15(2)5-6-17(7-8-20-15)10-12-9-11(14(18)19)3-4-13(12)16/h3-4,9H,5-8,10H2,1-2H3,(H,18,19) |
| InChIKey | MRLIADRIFJZYMT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |