C15H22N2S2 — CID 107455206
4-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]benzenecarbothioamide (PubChem CID 107455206) has the molecular formula C15H22N2S2 and a molecular weight of 294.49 g/mol. Its IUPAC name is 4-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]benzenecarbothioamide.
| Compound Name | 4-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107455206 |
| Molecular Formula | C15H22N2S2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]benzenecarbothioamide |
| SMILES | CC1(C)CCN(Cc2ccc(C(N)=S)cc2)CCS1 |
| InChI | InChI=1S/C15H22N2S2/c1-15(2)7-8-17(9-10-19-15)11-12-3-5-13(6-4-12)14(16)18/h3-6H,7-11H2,1-2H3,(H2,16,18) |
| InChIKey | FCCNBNPRKRLRHD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|