C16H24N2OS2 — CID 107455208
3-[2-(7,7-dimethyl-1,4-thiazepan-4-yl)ethoxy]benzenecarbothioamide (PubChem CID 107455208) has the molecular formula C16H24N2OS2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 3-[2-(7,7-dimethyl-1,4-thiazepan-4-yl)ethoxy]benzenecarbothioamide.
| Compound Name | 3-[2-(7,7-dimethyl-1,4-thiazepan-4-yl)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 107455208 |
| Molecular Formula | C16H24N2OS2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-[2-(7,7-dimethyl-1,4-thiazepan-4-yl)ethoxy]benzenecarbothioamide |
| SMILES | CC1(C)CCN(CCOc2cccc(C(N)=S)c2)CCS1 |
| InChI | InChI=1S/C16H24N2OS2/c1-16(2)6-7-18(9-11-21-16)8-10-19-14-5-3-4-13(12-14)15(17)20/h3-5,12H,6-11H2,1-2H3,(H2,17,20) |
| InChIKey | WOBGHDJSVILINK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|