C15H20N2OS2 — CID 107455050
3-(7,7-dimethyl-1,4-thiazepane-4-carbonyl)benzenecarbothioamide (PubChem CID 107455050) has the molecular formula C15H20N2OS2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 3-(7,7-dimethyl-1,4-thiazepane-4-carbonyl)benzenecarbothioamide.
| Compound Name | 3-(7,7-dimethyl-1,4-thiazepane-4-carbonyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 107455050 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3-(7,7-dimethyl-1,4-thiazepane-4-carbonyl)benzenecarbothioamide |
| SMILES | CC1(C)CCN(C(=O)c2cccc(C(N)=S)c2)CCS1 |
| InChI | InChI=1S/C15H20N2OS2/c1-15(2)6-7-17(8-9-20-15)14(18)12-5-3-4-11(10-12)13(16)19/h3-5,10H,6-9H2,1-2H3,(H2,16,19) |
| InChIKey | OXAIJGHTQMISNY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|