C17H26N2OS — CID 65281532
3-[2-(4,4-dimethylazepan-1-yl)ethoxy]benzenecarbothioamide (PubChem CID 65281532) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-[2-(4,4-dimethylazepan-1-yl)ethoxy]benzenecarbothioamide.
| Compound Name | 3-[2-(4,4-dimethylazepan-1-yl)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 65281532 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 3-[2-(4,4-dimethylazepan-1-yl)ethoxy]benzenecarbothioamide |
| SMILES | CC1(C)CCCN(CCOc2cccc(C(N)=S)c2)CC1 |
| InChI | InChI=1S/C17H26N2OS/c1-17(2)7-4-9-19(10-8-17)11-12-20-15-6-3-5-14(13-15)16(18)21/h3,5-6,13H,4,7-12H2,1-2H3,(H2,18,21) |
| InChIKey | WMGOAYCLOVOCSX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|