C14H17N3O3S — CID 66085276
3-[3-(3,5-dioxopiperazin-1-yl)propoxy]benzenecarbothioamide (PubChem CID 66085276) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 3-[3-(3,5-dioxopiperazin-1-yl)propoxy]benzenecarbothioamide.
| Compound Name | 3-[3-(3,5-dioxopiperazin-1-yl)propoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 66085276 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[3-(3,5-dioxopiperazin-1-yl)propoxy]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(OCCCN2CC(=O)NC(=O)C2)c1 |
| InChI | InChI=1S/C14H17N3O3S/c15-14(21)10-3-1-4-11(7-10)20-6-2-5-17-8-12(18)16-13(19)9-17/h1,3-4,7H,2,5-6,8-9H2,(H2,15,21)(H,16,18,19) |
| InChIKey | YINRYUQWQMYACT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|