C13H14N2O4S — CID 61313300
3-[2-(3,5-dioxomorpholin-4-yl)ethoxy]benzenecarbothioamide (PubChem CID 61313300) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[2-(3,5-dioxomorpholin-4-yl)ethoxy]benzenecarbothioamide.
| Compound Name | 3-[2-(3,5-dioxomorpholin-4-yl)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 61313300 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[2-(3,5-dioxomorpholin-4-yl)ethoxy]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(OCCN2C(=O)COCC2=O)c1 |
| InChI | InChI=1S/C13H14N2O4S/c14-13(20)9-2-1-3-10(6-9)19-5-4-15-11(16)7-18-8-12(15)17/h1-3,6H,4-5,7-8H2,(H2,14,20) |
| InChIKey | URPGGCJWHLICQE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|