C12H12BrNO4 — CID 54970412
4-[2-(4-bromophenoxy)ethyl]morpholine-3,5-dione (PubChem CID 54970412) has the molecular formula C12H12BrNO4 and a molecular weight of 314.13 g/mol. Its IUPAC name is 4-[2-(4-bromophenoxy)ethyl]morpholine-3,5-dione.
| Compound Name | 4-[2-(4-bromophenoxy)ethyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 54970412 |
| Molecular Formula | C12H12BrNO4 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 4-[2-(4-bromophenoxy)ethyl]morpholine-3,5-dione |
| SMILES | O=C1COCC(=O)N1CCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H12BrNO4/c13-9-1-3-10(4-2-9)18-6-5-14-11(15)7-17-8-12(14)16/h1-4H,5-8H2 |
| InChIKey | XHICUGVICOMJMF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|