C13H16N2O4 — CID 61312500
4-[2-[4-(aminomethyl)phenoxy]ethyl]morpholine-3,5-dione (PubChem CID 61312500) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-[2-[4-(aminomethyl)phenoxy]ethyl]morpholine-3,5-dione.
| Compound Name | 4-[2-[4-(aminomethyl)phenoxy]ethyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 61312500 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-[2-[4-(aminomethyl)phenoxy]ethyl]morpholine-3,5-dione |
| SMILES | NCc1ccc(OCCN2C(=O)COCC2=O)cc1 |
| InChI | InChI=1S/C13H16N2O4/c14-7-10-1-3-11(4-2-10)19-6-5-15-12(16)8-18-9-13(15)17/h1-4H,5-9,14H2 |
| InChIKey | JAAGIHWJRDQPLK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|