C15H21FN2S2 — CID 107455232
3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-fluorobenzenecarbothioamide (PubChem CID 107455232) has the molecular formula C15H21FN2S2 and a molecular weight of 312.48 g/mol. Its IUPAC name is 3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107455232 |
| Molecular Formula | C15H21FN2S2 |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-fluorobenzenecarbothioamide |
| SMILES | CC1(C)CCN(Cc2cccc(C(N)=S)c2F)CCS1 |
| InChI | InChI=1S/C15H21FN2S2/c1-15(2)6-7-18(8-9-20-15)10-11-4-3-5-12(13(11)16)14(17)19/h3-5H,6-10H2,1-2H3,(H2,17,19) |
| InChIKey | KXFHTOVABNAODR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|