C14H19FN2OS — CID 107115386
3-[(3,3-dimethylmorpholin-4-yl)methyl]-2-fluorobenzenecarbothioamide (PubChem CID 107115386) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-[(3,3-dimethylmorpholin-4-yl)methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 3-[(3,3-dimethylmorpholin-4-yl)methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107115386 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-[(3,3-dimethylmorpholin-4-yl)methyl]-2-fluorobenzenecarbothioamide |
| SMILES | CC1(C)COCCN1Cc1cccc(C(N)=S)c1F |
| InChI | InChI=1S/C14H19FN2OS/c1-14(2)9-18-7-6-17(14)8-10-4-3-5-11(12(10)15)13(16)19/h3-5H,6-9H2,1-2H3,(H2,16,19) |
| InChIKey | QUSRZTUHHBCOJR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|