C16H25N3OS — CID 107455552
4-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-methoxybenzenecarboximidamide (PubChem CID 107455552) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 4-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-methoxybenzenecarboximidamide.
| Compound Name | 4-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107455552 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-2-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CCSC(C)(C)CC2)cc1OC |
| InChI | InChI=1S/C16H25N3OS/c1-16(2)6-7-19(8-9-21-16)11-12-4-5-13(15(17)18)14(10-12)20-3/h4-5,10H,6-9,11H2,1-3H3,(H3,17,18) |
| InChIKey | UKHFFMHGOUEGSR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|