C13H19N3O2S — CID 106790715
2-methoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzenecarboximidamide (PubChem CID 106790715) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-methoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzenecarboximidamide.
| Compound Name | 2-methoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 106790715 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-methoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CCS(=O)CC2)cc1OC |
| InChI | InChI=1S/C13H19N3O2S/c1-18-12-8-10(2-3-11(12)13(14)15)9-16-4-6-19(17)7-5-16/h2-3,8H,4-7,9H2,1H3,(H3,14,15) |
| InChIKey | LNTPWZBRKWXUPM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|