C13H17NO4S — CID 106793536
2-methoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid (PubChem CID 106793536) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-methoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid.
| Compound Name | 2-methoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 106793536 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-methoxy-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzoic acid |
| SMILES | COc1cc(CN2CCS(=O)CC2)ccc1C(=O)O |
| InChI | InChI=1S/C13H17NO4S/c1-18-12-8-10(2-3-11(12)13(15)16)9-14-4-6-19(17)7-5-14/h2-3,8H,4-7,9H2,1H3,(H,15,16) |
| InChIKey | JMKQURPUGLTRFR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |