C17H23NO3 — CID 106793672
4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-2-methoxybenzoic acid (PubChem CID 106793672) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-2-methoxybenzoic acid.
| Compound Name | 4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 106793672 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 4-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-ylmethyl)-2-methoxybenzoic acid |
| SMILES | COc1cc(CN2CCCC3CCCC32)ccc1C(=O)O |
| InChI | InChI=1S/C17H23NO3/c1-21-16-10-12(7-8-14(16)17(19)20)11-18-9-3-5-13-4-2-6-15(13)18/h7-8,10,13,15H,2-6,9,11H2,1H3,(H,19,20) |
| InChIKey | XJAVETYJNDUNAB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |