C17H24INO2 — CID 2846087
4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-2-iodo-6-methoxyphenol (PubChem CID 2846087) has the molecular formula C17H24INO2 and a molecular weight of 401.29 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-2-iodo-6-methoxyphenol.
| Compound Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 2846087 |
| Molecular Formula | C17H24INO2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-2-iodo-6-methoxyphenol |
| SMILES | COc1cc(CN2CCCC3CCCCC32)cc(I)c1O |
| InChI | InChI=1S/C17H24INO2/c1-21-16-10-12(9-14(18)17(16)20)11-19-8-4-6-13-5-2-3-7-15(13)19/h9-10,13,15,20H,2-8,11H2,1H3 |
| InChIKey | JZAASMHKFMEDIL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|