C18H27IN2O3 — CID 2846014
N,N-diethyl-1-[(4-hydroxy-3-iodo-5-methoxyphenyl)methyl]piperidine-3-carboxamide (PubChem CID 2846014) has the molecular formula C18H27IN2O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is N,N-diethyl-1-[(4-hydroxy-3-iodo-5-methoxyphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N,N-diethyl-1-[(4-hydroxy-3-iodo-5-methoxyphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 2846014 |
| Molecular Formula | C18H27IN2O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N,N-diethyl-1-[(4-hydroxy-3-iodo-5-methoxyphenyl)methyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(Cc2cc(I)c(O)c(OC)c2)C1 |
| InChI | InChI=1S/C18H27IN2O3/c1-4-21(5-2)18(23)14-7-6-8-20(12-14)11-13-9-15(19)17(22)16(10-13)24-3/h9-10,14,22H,4-8,11-12H2,1-3H3 |
| InChIKey | UJDNIAVEGBLNDR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|