C16H22INO4 — CID 7444843
ethyl (3S)-1-[(4-hydroxy-3-iodo-5-methoxyphenyl)methyl]piperidine-3-carboxylate (PubChem CID 7444843) has the molecular formula C16H22INO4 and a molecular weight of 419.26 g/mol. Its IUPAC name is ethyl (3S)-1-[(4-hydroxy-3-iodo-5-methoxyphenyl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(4-hydroxy-3-iodo-5-methoxyphenyl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 7444843 |
| Molecular Formula | C16H22INO4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | ethyl (3S)-1-[(4-hydroxy-3-iodo-5-methoxyphenyl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(Cc2cc(I)c(O)c(OC)c2)C1 |
| InChI | InChI=1S/C16H22INO4/c1-3-22-16(20)12-5-4-6-18(10-12)9-11-7-13(17)15(19)14(8-11)21-2/h7-8,12,19H,3-6,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | OTNQYEDDFJUWEP-LBPRGKRZSA-N |
| XLogP | 2.78 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|