C24H32N2O9 — CID 2901135
4-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol;oxalic acid (PubChem CID 2901135) has the molecular formula C24H32N2O9 and a molecular weight of 492.53 g/mol. Its IUPAC name is 4-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol;oxalic acid.
| Compound Name | 4-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol;oxalic acid |
|---|---|
| PubChem CID | 2901135 |
| Molecular Formula | C24H32N2O9 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 4-[[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol;oxalic acid |
| SMILES | COc1ccc(CN2CCN(Cc3cc(OC)c(O)c(OC)c3)CC2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H30N2O5.C2H2O4/c1-26-18-6-5-16(11-19(18)27-2)14-23-7-9-24(10-8-23)15-17-12-20(28-3)22(25)21(13-17)29-4;3-1(4)2(5)6/h5-6,11-13,25H,7-10,14-15H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | XYPUBXMHPWGYDZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|