C30H35N3O7 — CID 17366841
4-[[4-[(9-ethylcarbazol-3-yl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol;oxalic acid (PubChem CID 17366841) has the molecular formula C30H35N3O7 and a molecular weight of 549.62 g/mol. Its IUPAC name is 4-[[4-[(9-ethylcarbazol-3-yl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol;oxalic acid.
| Compound Name | 4-[[4-[(9-ethylcarbazol-3-yl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol;oxalic acid |
|---|---|
| PubChem CID | 17366841 |
| Molecular Formula | C30H35N3O7 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 4-[[4-[(9-ethylcarbazol-3-yl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol;oxalic acid |
| SMILES | CCn1c2ccccc2c2cc(CN3CCN(Cc4cc(OC)c(O)c(OC)c4)CC3)ccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C28H33N3O3.C2H2O4/c1-4-31-24-8-6-5-7-22(24)23-15-20(9-10-25(23)31)18-29-11-13-30(14-12-29)19-21-16-26(33-2)28(32)27(17-21)34-3;3-1(4)2(5)6/h5-10,15-17,32H,4,11-14,18-19H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | QNFXHOWEGKRAOX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 124.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|