C29H32BrN3O5 — CID 2874389
3-[[4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-1-yl]methyl]-9-ethylcarbazole;oxalic acid (PubChem CID 2874389) has the molecular formula C29H32BrN3O5 and a molecular weight of 582.50 g/mol. Its IUPAC name is 3-[[4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-1-yl]methyl]-9-ethylcarbazole;oxalic acid.
| Compound Name | 3-[[4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-1-yl]methyl]-9-ethylcarbazole;oxalic acid |
|---|---|
| PubChem CID | 2874389 |
| Molecular Formula | C29H32BrN3O5 |
| Molecular Weight | 582.50 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 3-[[4-[(3-bromo-4-methoxyphenyl)methyl]piperazin-1-yl]methyl]-9-ethylcarbazole;oxalic acid |
| SMILES | CCn1c2ccccc2c2cc(CN3CCN(Cc4ccc(OC)c(Br)c4)CC3)ccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H30BrN3O.C2H2O4/c1-3-31-25-7-5-4-6-22(25)23-16-20(8-10-26(23)31)18-29-12-14-30(15-13-29)19-21-9-11-27(32-2)24(28)17-21;3-1(4)2(5)6/h4-11,16-17H,3,12-15,18-19H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ITSPLPSQMUFUTI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|