C27H28N4O8S — CID 90483306
9-ethyl-3-[[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methyl]carbazole;oxalic acid (PubChem CID 90483306) has the molecular formula C27H28N4O8S and a molecular weight of 568.61 g/mol. Its IUPAC name is 9-ethyl-3-[[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methyl]carbazole;oxalic acid.
| Compound Name | 9-ethyl-3-[[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methyl]carbazole;oxalic acid |
|---|---|
| PubChem CID | 90483306 |
| Molecular Formula | C27H28N4O8S |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 9-ethyl-3-[[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]methyl]carbazole;oxalic acid |
| SMILES | CCn1c2ccccc2c2cc(CN3CCN(S(=O)(=O)c4ccccc4[N+](=O)[O-])CC3)ccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H26N4O4S.C2H2O4/c1-2-28-22-8-4-3-7-20(22)21-17-19(11-12-23(21)28)18-26-13-15-27(16-14-26)34(32,33)25-10-6-5-9-24(25)29(30)31;3-1(4)2(5)6/h3-12,17H,2,13-16,18H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | SKUJKPGAKNPDKF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|