C15H21N3O10S2 — CID 171154767
1-(2-nitrophenyl)sulfonyl-4-propylsulfonylpiperazine;oxalic acid (PubChem CID 171154767) has the molecular formula C15H21N3O10S2 and a molecular weight of 467.48 g/mol. Its IUPAC name is 1-(2-nitrophenyl)sulfonyl-4-propylsulfonylpiperazine;oxalic acid.
| Compound Name | 1-(2-nitrophenyl)sulfonyl-4-propylsulfonylpiperazine;oxalic acid |
|---|---|
| PubChem CID | 171154767 |
| Molecular Formula | C15H21N3O10S2 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 1-(2-nitrophenyl)sulfonyl-4-propylsulfonylpiperazine;oxalic acid |
| SMILES | CCCS(=O)(=O)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H19N3O6S2.C2H2O4/c1-2-11-23(19,20)14-7-9-15(10-8-14)24(21,22)13-6-4-3-5-12(13)16(17)18;3-1(4)2(5)6/h3-6H,2,7-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | HMWZNXPYSWKACP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 192.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|