C20H23N3O9S — CID 2901744
1-[(2-methoxyphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazine;oxalic acid (PubChem CID 2901744) has the molecular formula C20H23N3O9S and a molecular weight of 481.48 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazine;oxalic acid.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazine;oxalic acid |
|---|---|
| PubChem CID | 2901744 |
| Molecular Formula | C20H23N3O9S |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazine;oxalic acid |
| SMILES | COc1ccccc1CN1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H21N3O5S.C2H2O4/c1-26-17-8-4-2-6-15(17)14-19-10-12-20(13-11-19)27(24,25)18-9-5-3-7-16(18)21(22)23;3-1(4)2(5)6/h2-9H,10-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KZSLCOBZGUGNIB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 167.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|