C21H25N3O10S — CID 90483389
1-[(2,3-dimethoxyphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazine;oxalic acid (PubChem CID 90483389) has the molecular formula C21H25N3O10S and a molecular weight of 511.51 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazine;oxalic acid.
| Compound Name | 1-[(2,3-dimethoxyphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazine;oxalic acid |
|---|---|
| PubChem CID | 90483389 |
| Molecular Formula | C21H25N3O10S |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)methyl]-4-(2-nitrophenyl)sulfonylpiperazine;oxalic acid |
| SMILES | COc1cccc(CN2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC2)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H23N3O6S.C2H2O4/c1-27-17-8-5-6-15(19(17)28-2)14-20-10-12-21(13-11-20)29(25,26)18-9-4-3-7-16(18)22(23)24;3-1(4)2(5)6/h3-9H,10-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | UUKWUMXAAMJSPH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 176.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|