C28H32N2O6 — CID 163328266
1-benzhydryl-4-[(2,3-dimethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 163328266) has the molecular formula C28H32N2O6 and a molecular weight of 492.57 g/mol. Its IUPAC name is 1-benzhydryl-4-[(2,3-dimethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-benzhydryl-4-[(2,3-dimethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 163328266 |
| Molecular Formula | C28H32N2O6 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 1-benzhydryl-4-[(2,3-dimethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | COc1cccc(CN2CCN(C(c3ccccc3)c3ccccc3)CC2)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H30N2O2.C2H2O4/c1-29-24-15-9-14-23(26(24)30-2)20-27-16-18-28(19-17-27)25(21-10-5-3-6-11-21)22-12-7-4-8-13-22;3-1(4)2(5)6/h3-15,25H,16-20H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | PUCMCTVAHZTWGC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|