C28H32N2O5 — CID 163328320
1-benzhydryl-4-[(2-ethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 163328320) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 1-benzhydryl-4-[(2-ethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-benzhydryl-4-[(2-ethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 163328320 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 1-benzhydryl-4-[(2-ethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | CCOc1ccccc1CN1CCN(C(c2ccccc2)c2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H30N2O.C2H2O4/c1-2-29-25-16-10-9-15-24(25)21-27-17-19-28(20-18-27)26(22-11-5-3-6-12-22)23-13-7-4-8-14-23;3-1(4)2(5)6/h3-16,26H,2,17-21H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | RMWWBABAOYJBIM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|