C24H31N3O10 — CID 126476430
1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-[(2,3-dimethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 126476430) has the molecular formula C24H31N3O10 and a molecular weight of 521.52 g/mol. Its IUPAC name is 1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-[(2,3-dimethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-[(2,3-dimethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 126476430 |
| Molecular Formula | C24H31N3O10 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-[(2,3-dimethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | COc1cc(CN2CCN(Cc3cccc(OC)c3OC)CC2)c([N+](=O)[O-])cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H29N3O6.C2H2O4/c1-28-19-7-5-6-16(22(19)31-4)14-23-8-10-24(11-9-23)15-17-12-20(29-2)21(30-3)13-18(17)25(26)27;3-1(4)2(5)6/h5-7,12-13H,8-11,14-15H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | SPEGCIDMTKAMLL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 161.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|