C22H27N3O9 — CID 90483640
2,6-dimethoxy-4-[[4-[(2-nitrophenyl)methyl]piperazin-1-yl]methyl]phenol;oxalic acid (PubChem CID 90483640) has the molecular formula C22H27N3O9 and a molecular weight of 477.47 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[[4-[(2-nitrophenyl)methyl]piperazin-1-yl]methyl]phenol;oxalic acid.
| Compound Name | 2,6-dimethoxy-4-[[4-[(2-nitrophenyl)methyl]piperazin-1-yl]methyl]phenol;oxalic acid |
|---|---|
| PubChem CID | 90483640 |
| Molecular Formula | C22H27N3O9 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2,6-dimethoxy-4-[[4-[(2-nitrophenyl)methyl]piperazin-1-yl]methyl]phenol;oxalic acid |
| SMILES | COc1cc(CN2CCN(Cc3ccccc3[N+](=O)[O-])CC2)cc(OC)c1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H25N3O5.C2H2O4/c1-27-18-11-15(12-19(28-2)20(18)24)13-21-7-9-22(10-8-21)14-16-5-3-4-6-17(16)23(25)26;3-1(4)2(5)6/h3-6,11-12,24H,7-10,13-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DCCNESGMOTYKMI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 162.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|