C20H25BrN2O3 — CID 1131780
4-[[4-[(2-bromophenyl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol (PubChem CID 1131780) has the molecular formula C20H25BrN2O3 and a molecular weight of 421.34 g/mol. Its IUPAC name is 4-[[4-[(2-bromophenyl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[[4-[(2-bromophenyl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 1131780 |
| Molecular Formula | C20H25BrN2O3 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 4-[[4-[(2-bromophenyl)methyl]piperazin-1-yl]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CN2CCN(Cc3ccccc3Br)CC2)cc(OC)c1O |
| InChI | InChI=1S/C20H25BrN2O3/c1-25-18-11-15(12-19(26-2)20(18)24)13-22-7-9-23(10-8-22)14-16-5-3-4-6-17(16)21/h3-6,11-12,24H,7-10,13-14H2,1-2H3 |
| InChIKey | CDARZOCGNSEQCX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |