C19H24N2O3 — CID 791376
2,6-dimethoxy-4-[(4-phenylpiperazin-1-yl)methyl]phenol (PubChem CID 791376) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(4-phenylpiperazin-1-yl)methyl]phenol.
| Compound Name | 2,6-dimethoxy-4-[(4-phenylpiperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 791376 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2,6-dimethoxy-4-[(4-phenylpiperazin-1-yl)methyl]phenol |
| SMILES | COc1cc(CN2CCN(c3ccccc3)CC2)cc(OC)c1O |
| InChI | InChI=1S/C19H24N2O3/c1-23-17-12-15(13-18(24-2)19(17)22)14-20-8-10-21(11-9-20)16-6-4-3-5-7-16/h3-7,12-13,22H,8-11,14H2,1-2H3 |
| InChIKey | WTZREYVEPJUCHO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |