C19H25N3O2 — CID 82183738
2,3-dimethoxy-5-[(4-phenylpiperazin-1-yl)methyl]aniline (PubChem CID 82183738) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[(4-phenylpiperazin-1-yl)methyl]aniline.
| Compound Name | 2,3-dimethoxy-5-[(4-phenylpiperazin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 82183738 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2,3-dimethoxy-5-[(4-phenylpiperazin-1-yl)methyl]aniline |
| SMILES | COc1cc(CN2CCN(c3ccccc3)CC2)cc(N)c1OC |
| InChI | InChI=1S/C19H25N3O2/c1-23-18-13-15(12-17(20)19(18)24-2)14-21-8-10-22(11-9-21)16-6-4-3-5-7-16/h3-7,12-13H,8-11,14,20H2,1-2H3 |
| InChIKey | IWFZWCZHTPXXIF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|