C20H26ClN3O3 — CID 18403872
[2-methoxy-4-[(4-phenylpiperazin-1-yl)methyl]phenyl] N-methylcarbamate;hydrochloride (PubChem CID 18403872) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is [2-methoxy-4-[(4-phenylpiperazin-1-yl)methyl]phenyl] N-methylcarbamate;hydrochloride.
| Compound Name | [2-methoxy-4-[(4-phenylpiperazin-1-yl)methyl]phenyl] N-methylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 18403872 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | [2-methoxy-4-[(4-phenylpiperazin-1-yl)methyl]phenyl] N-methylcarbamate;hydrochloride |
| SMILES | CNC(=O)Oc1ccc(CN2CCN(c3ccccc3)CC2)cc1OC.Cl |
| InChI | InChI=1S/C20H25N3O3.ClH/c1-21-20(24)26-18-9-8-16(14-19(18)25-2)15-22-10-12-23(13-11-22)17-6-4-3-5-7-17;/h3-9,14H,10-13,15H2,1-2H3,(H,21,24);1H |
| InChIKey | WKYUNAGNNAHXPT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |