C29H29N3O4 — CID 145113139
[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl] isoquinoline-3-carboxylate (PubChem CID 145113139) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is [4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl] isoquinoline-3-carboxylate.
| Compound Name | [4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl] isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 145113139 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | [4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl] isoquinoline-3-carboxylate |
| SMILES | COc1ccc(CN2CCN(c3ccc(OC(=O)c4cc5ccccc5cn4)cc3)CC2)cc1OC |
| InChI | InChI=1S/C29H29N3O4/c1-34-27-12-7-21(17-28(27)35-2)20-31-13-15-32(16-14-31)24-8-10-25(11-9-24)36-29(33)26-18-22-5-3-4-6-23(22)19-30-26/h3-12,17-19H,13-16,20H2,1-2H3 |
| InChIKey | NPGRFDRVJGDRNP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|