C33H41N3O3S — CID 145113085
ethane;2-methoxy-5-[[4-[4-(naphthalen-2-ylsulfanylamino)phenyl]piperazin-1-yl]methyl]benzoic acid (PubChem CID 145113085) has the molecular formula C33H41N3O3S and a molecular weight of 559.78 g/mol. Its IUPAC name is ethane;2-methoxy-5-[[4-[4-(naphthalen-2-ylsulfanylamino)phenyl]piperazin-1-yl]methyl]benzoic acid.
| Compound Name | ethane;2-methoxy-5-[[4-[4-(naphthalen-2-ylsulfanylamino)phenyl]piperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 145113085 |
| Molecular Formula | C33H41N3O3S |
| Molecular Weight | 559.78 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | ethane;2-methoxy-5-[[4-[4-(naphthalen-2-ylsulfanylamino)phenyl]piperazin-1-yl]methyl]benzoic acid |
| SMILES | CC.CC.COc1ccc(CN2CCN(c3ccc(NSc4ccc5ccccc5c4)cc3)CC2)cc1C(=O)O |
| InChI | InChI=1S/C29H29N3O3S.2C2H6/c1-35-28-13-6-21(18-27(28)29(33)34)20-31-14-16-32(17-15-31)25-10-8-24(9-11-25)30-36-26-12-7-22-4-2-3-5-23(22)19-26;2*1-2/h2-13,18-19,30H,14-17,20H2,1H3,(H,33,34);2*1-2H3 |
| InChIKey | WLNHQJBHCVLWFU-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.78 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|