C26H29N3O3 — CID 1394950
N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,5-dimethoxybenzamide (PubChem CID 1394950) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 1394950 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)c1 |
| InChI | InChI=1S/C26H29N3O3/c1-31-24-16-21(17-25(18-24)32-2)26(30)27-22-8-10-23(11-9-22)29-14-12-28(13-15-29)19-20-6-4-3-5-7-20/h3-11,16-18H,12-15,19H2,1-2H3,(H,27,30) |
| InChIKey | SHVQJQXPPHQGGA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|