C29H33N3O3 — CID 42315505
N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,4-dimethoxy-5-prop-2-enylbenzamide (PubChem CID 42315505) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,4-dimethoxy-5-prop-2-enylbenzamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 42315505 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)phenyl]-3,4-dimethoxy-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H33N3O3/c1-4-8-23-19-24(20-27(34-2)28(23)35-3)29(33)30-25-11-13-26(14-12-25)32-17-15-31(16-18-32)21-22-9-6-5-7-10-22/h4-7,9-14,19-20H,1,8,15-18,21H2,2-3H3,(H,30,33) |
| InChIKey | ZMOLTSBHQARSCP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|