C28H31N3O3 — CID 46524125
(E)-N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide (PubChem CID 46524125) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is (E)-N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46524125 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (E)-N-[4-(4-benzylpiperazin-1-yl)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)c1OC |
| InChI | InChI=1S/C28H31N3O3/c1-33-26-10-6-9-23(28(26)34-2)11-16-27(32)29-24-12-14-25(15-13-24)31-19-17-30(18-20-31)21-22-7-4-3-5-8-22/h3-16H,17-21H2,1-2H3,(H,29,32)/b16-11+ |
| InChIKey | MZCKIHLAPMVBGM-LFIBNONCSA-N |
| XLogP | 4.68 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|