C27H26Cl3N3O2 — CID 3573638
N-[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 3573638) has the molecular formula C27H26Cl3N3O2 and a molecular weight of 530.88 g/mol. Its IUPAC name is N-[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3573638 |
| Molecular Formula | C27H26Cl3N3O2 |
| Molecular Weight | 530.88 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | N-[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1ccc(N2CCN(Cc3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C27H26Cl3N3O2/c1-35-27-19(16-21(28)17-25(27)30)6-11-26(34)31-22-7-9-23(10-8-22)33-14-12-32(13-15-33)18-20-4-2-3-5-24(20)29/h2-11,16-17H,12-15,18H2,1H3,(H,31,34) |
| InChIKey | FUCDIFRFGATAQH-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.88 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|