C16H12BrCl2NO2 — CID 1395964
N-(4-bromophenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 1395964) has the molecular formula C16H12BrCl2NO2 and a molecular weight of 401.09 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-(4-bromophenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1395964 |
| Molecular Formula | C16H12BrCl2NO2 |
| Molecular Weight | 401.09 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | N-(4-bromophenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrCl2NO2/c1-22-16-10(8-12(18)9-14(16)19)2-7-15(21)20-13-5-3-11(17)4-6-13/h2-9H,1H3,(H,20,21) |
| InChIKey | UAUBIBVHDPOMNZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.09 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|