C16H11Cl4NO2 — CID 4004961
3-(3,5-dichloro-2-methoxyphenyl)-N-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 4004961) has the molecular formula C16H11Cl4NO2 and a molecular weight of 391.08 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-methoxyphenyl)-N-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4004961 |
| Molecular Formula | C16H11Cl4NO2 |
| Molecular Weight | 391.08 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl4NO2/c1-23-16-9(6-11(18)8-13(16)20)2-5-15(22)21-14-4-3-10(17)7-12(14)19/h2-8H,1H3,(H,21,22) |
| InChIKey | QCWBJDBGPQCEIW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.08 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|