C22H17Cl2NO2 — CID 3922854
3-(3,5-dichloro-2-methoxyphenyl)-N-(1,2-dihydroacenaphthylen-5-yl)prop-2-enamide (PubChem CID 3922854) has the molecular formula C22H17Cl2NO2 and a molecular weight of 398.29 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-methoxyphenyl)-N-(1,2-dihydroacenaphthylen-5-yl)prop-2-enamide.
| Compound Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-(1,2-dihydroacenaphthylen-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3922854 |
| Molecular Formula | C22H17Cl2NO2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-(1,2-dihydroacenaphthylen-5-yl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C22H17Cl2NO2/c1-27-22-15(11-16(23)12-18(22)24)8-10-20(26)25-19-9-7-14-6-5-13-3-2-4-17(19)21(13)14/h2-4,7-12H,5-6H2,1H3,(H,25,26) |
| InChIKey | FVPHXQTXISNXTP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|