C19H18Cl2N2O3 — CID 1421909
3-(3,5-dichloro-2-methoxyphenyl)-N-[4-(propanoylamino)phenyl]prop-2-enamide (PubChem CID 1421909) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-methoxyphenyl)-N-[4-(propanoylamino)phenyl]prop-2-enamide.
| Compound Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-[4-(propanoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1421909 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-[4-(propanoylamino)phenyl]prop-2-enamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)C=Cc2cc(Cl)cc(Cl)c2OC)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O3/c1-3-17(24)22-14-5-7-15(8-6-14)23-18(25)9-4-12-10-13(20)11-16(21)19(12)26-2/h4-11H,3H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | FIDRVYMJUUEWFI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|