C20H21Cl2NO2 — CID 4676710
N-(4-butan-2-ylphenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 4676710) has the molecular formula C20H21Cl2NO2 and a molecular weight of 378.30 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-(4-butan-2-ylphenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4676710 |
| Molecular Formula | C20H21Cl2NO2 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | CCC(C)c1ccc(NC(=O)C=Cc2cc(Cl)cc(Cl)c2OC)cc1 |
| InChI | InChI=1S/C20H21Cl2NO2/c1-4-13(2)14-5-8-17(9-6-14)23-19(24)10-7-15-11-16(21)12-18(22)20(15)25-3/h5-13H,4H2,1-3H3,(H,23,24) |
| InChIKey | ZECCTYHWNHECMF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|