C22H24Cl2N2O2 — CID 4008558
3-(3,5-dichloro-2-methoxyphenyl)-N-[4-(4-methylpiperidin-1-yl)phenyl]prop-2-enamide (PubChem CID 4008558) has the molecular formula C22H24Cl2N2O2 and a molecular weight of 419.35 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-methoxyphenyl)-N-[4-(4-methylpiperidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-[4-(4-methylpiperidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4008558 |
| Molecular Formula | C22H24Cl2N2O2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-[4-(4-methylpiperidin-1-yl)phenyl]prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1ccc(N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C22H24Cl2N2O2/c1-15-9-11-26(12-10-15)19-6-4-18(5-7-19)25-21(27)8-3-16-13-17(23)14-20(24)22(16)28-2/h3-8,13-15H,9-12H2,1-2H3,(H,25,27) |
| InChIKey | ZPHIKYLNIPUMRR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|