C21H22Cl2N2O4 — CID 17358373
(E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(5-methoxy-2-morpholin-4-ylphenyl)prop-2-enamide (PubChem CID 17358373) has the molecular formula C21H22Cl2N2O4 and a molecular weight of 437.32 g/mol. Its IUPAC name is (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(5-methoxy-2-morpholin-4-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(5-methoxy-2-morpholin-4-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17358373 |
| Molecular Formula | C21H22Cl2N2O4 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(5-methoxy-2-morpholin-4-ylphenyl)prop-2-enamide |
| SMILES | COc1ccc(N2CCOCC2)c(NC(=O)/C=C/c2cc(Cl)cc(Cl)c2OC)c1 |
| InChI | InChI=1S/C21H22Cl2N2O4/c1-27-16-4-5-19(25-7-9-29-10-8-25)18(13-16)24-20(26)6-3-14-11-15(22)12-17(23)21(14)28-2/h3-6,11-13H,7-10H2,1-2H3,(H,24,26)/b6-3+ |
| InChIKey | ZNCUTPZXKBPBOV-ZZXKWVIFSA-N |
| XLogP | 4.50 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|