C17H14BrCl2NO2 — CID 1397404
(E)-N-(4-bromo-2-methylphenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 1397404) has the molecular formula C17H14BrCl2NO2 and a molecular weight of 415.11 g/mol. Its IUPAC name is (E)-N-(4-bromo-2-methylphenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-bromo-2-methylphenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1397404 |
| Molecular Formula | C17H14BrCl2NO2 |
| Molecular Weight | 415.11 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | (E)-N-(4-bromo-2-methylphenyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=C/C(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C17H14BrCl2NO2/c1-10-7-12(18)4-5-15(10)21-16(22)6-3-11-8-13(19)9-14(20)17(11)23-2/h3-9H,1-2H3,(H,21,22)/b6-3+ |
| InChIKey | SOUNVOIEOFNZDX-ZZXKWVIFSA-N |
| XLogP | 5.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.11 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|